{
    "accession": "MITE0000030",
    "status": "active",
    "comment": "Mismatch between protein sequences of UniProt A8CF74 and GenPept ABV56598.1 - UniProt sequence correct.",
    "changelog": [
        {
            "version": "1",
            "date": "2024-07-30",
            "contributors": [
                "0009-0006-9871-5187",
                "AAAAAAAAAAAAAAAAAAAAAAAA"
            ],
            "reviewers": [
                "0000-0003-4819-2251"
            ],
            "comment": "Initial entry. Reviewer 1 corrected SMARTS, added information in the description fields for the reaction entries."
        },
        {
            "version": "2",
            "date": "2025-07-25",
            "contributors": [
                "AAAAAAAAAAAAAAAAAAAAAAAA"
            ],
            "reviewers": [
                "0000-0001-6534-6609"
            ],
            "comment": "Added cofactor information"
        },
        {
            "version": "3",
            "date": "2025-08-26",
            "contributors": [
                "AAAAAAAAAAAAAAAAAAAAAAAA"
            ],
            "reviewers": [
                "0000-0001-6534-6609"
            ],
            "comment": "Fixed reaction SMARTS indexing."
        }
    ],
    "enzyme": {
        "name": "KtzR",
        "description": "Flavin-dependent halogenase",
        "references": [
            "doi:10.1021/ja806467a"
        ],
        "databaseIds": {
            "uniprot": "A8CF74",
            "genpept": "ABV56598.1",
            "mibig": "BGC0000378"
        },
        "cofactors": {
            "organic": [
                "FAD"
            ]
        }
    },
    "reactions": [
        {
            "tailoring": [
                "Halogenation"
            ],
            "description": "KtzR is a regiospecific halogenase that catalyzes chlorination at the 6-position of 7-Cl-L-Tryptophan to generate 6,7-diCl-L-Trp.",
            "reactionSMARTS": "[#7:1]-[#6:2](-[#6:14](-[#8:16])=[#8:15])-[#6:3]-[#6:4]1:[#6:13]2:[#6:7](:[#6:8](:[#6:10]:[#6:11]:[#6:12]:2)-[Cl:9]):[#7:6]:[#6:5]:1>>[#7:1]-[#6:2](-[#6:14](-[#8:16])=[#8:15])-[#6:3]-[#6:4]1:[#6:13]2:[#6:7](:[#6:8](:[#6:10](-[Cl]):[#6:11]:[#6:12]:2)-[Cl:9]):[#7:6]:[#6:5]:1",
            "reactions": [
                {
                    "substrate": "NC(Cc1c[nH]c2c(Cl)cccc12)C(=O)O",
                    "products": [
                        "NC(Cc1c[nH]c2c(Cl)c(Cl)ccc12)C(=O)O"
                    ],
                    "isIntermediate": true,
                    "description": "C6 chlorination of 7-Cl-L-tryptophan"
                }
            ],
            "evidence": {
                "evidenceCode": [
                    "In vitro assay"
                ],
                "references": [
                    "doi:10.1021/ja806467a"
                ]
            },
            "databaseIds": {
                "rhea": "55904",
                "ec": "1.14.19.60"
            }
        }
    ]
}